Febuksostat: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
k Bot: Perubahan kosmetika |
menambahkan templat drugbox Febuxostat |
||
Baris 1:
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 459437484
| image = Febuxostat.svg
<!--Clinical data-->
| tradename = Uloric, Adenuric, others<ref name=drugnames/>
| Drugs.com = {{drugs.com|monograph|febuxostat}}
| MedlinePlus = a609020
| DailyMedID = Febuxostat
| licence_EU = yes
| licence_US = Febuxostat
| pregnancy_AU = B1
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Febuxostat (Uloric) Use During Pregnancy | website=Drugs.com | date=22 February 2019 | url=https://www.drugs.com/pregnancy/febuxostat.html | access-date=17 May 2020}}</ref>
| pregnancy_US = N
| pregnancy_US_comment = <ref name="Drugs.com pregnancy" />
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = Rx-only
| legal_EU = Rx-only
| legal_status =
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability diabsorpsi = ≥84%
| protein_bound = 99.2% pada albumin
| metabolism = via [[CYP1A1]], [[CYP1A2|1A2]], [[CYP2C8|2C8]], [[CYP2C9|2C9]], [[UGT1A1]], [[UGT1A8|1A8]], [[UGT1A9|1A9]]<ref name="EMA" />
| elimination_half-life = ~5–8 jam
| excretion = Urine (~49%, mayoritas sebagai metabolit, 3% sebagai bentuk obat); feces (~45%, mayoritas sebagai metabolit, 12% as sebagai bentuk obat)
<!--Identifiers-->
| IUPHAR_ligand = 6817
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 144060-53-7
| ATC_prefix = M04
| ATC_suffix = AA03
| ATC_supplemental =
| PubChem = 134018
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB04854
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 118173
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 101V0R1N2E
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01206
| ChEBI = 31596
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1164729
<!--Chemical data-->
| IUPAC_name = 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-<br />1,3-thiazole-5-carboxylic acid
| C=16 | H=16 | N=2 | Na= | O=3 | S=1
| smiles = N#Cc1c(OCC(C)C)ccc(c1)c2nc(c(s2)C(=O)O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BQSJTQLCZDPROO-UHFFFAOYSA-N
}}
'''Febuksostat''', dijual dengan nama '''Uloric''' di negara-negara benua Amerika dan '''Adenuric''' untuk pasar [[Uni Eropa]], adalah obat yang digunakan untuk pengobatan [[pirai]] kronis dan [[hiperurisemia]]. Febuksostat menghambat enzim ''[[xanthine oxidase]]'', sehingga mengurangi produksi asam urat di dalam tubuh. Obat ini biasanya hanya disarankan untuk mereka yang tidak dapat menoleransi [[alopurinol]].<ref>{{cite web|title=Febuxostat for the management of hyperuricaemia in people with gout Guidance and guidelines|url=https://www.nice.org.uk/guidance/TA164|website=www.nice.org.uk|accessdate=28 March 2017|date=17 December 2008|deadurl=no|archiveurl=https://web.archive.org/web/20170328195736/https://www.nice.org.uk/guidance/TA164|archivedate=28 March 2017|df=}}</ref> Obat ini lebih efektif daripada alopurinol dengan dosis standar, tetapi tidak lebih efektif dari alopurinol dengan dosis tinggi.<ref name=NICE>[http://guidance.nice.org.uk/TA164/Guidance/Considerations_1 Febuxostat for the management of hyperuricaemia in people with gout (TA164) Chapter 4. Consideration of the evidence] {{webarchive |url=https://web.archive.org/web/20101006212851/http://guidance.nice.org.uk/TA164/Guidance/Considerations_1 |date=October 6, 2010 }}</ref> Namun, obat ini lebih sering menimbulkan kekhawatiran mengenai kematian yang berkaitan dengan jantung bila dibandingkan dengan alopurinol.<ref>{{cite web|title=Safety Alerts for Human Medical Products - Uloric (febuxostat): Drug Safety Communication - FDA to Evaluate Increased Risk of Heart-related Death|url=https://www.fda.gov/Safety/MedWatch/SafetyInformation/SafetyAlertsforHumanMedicalProducts/ucm585281.htm|website=FDA|accessdate=21 November 2017|language=en}}</ref>
| |||