Astaksantin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
k Johnstad Di Maria memindahkan halaman Astaksantin ke Astaxantin: Penggunaan huruf X dalam istilah ilmiah diperbolehkan |
menambahkan infoboc astaxantin |
||
Baris 1:
{{refimprove|date=April 2014}}{{chembox
| ImageFile = Astaxanthin.svg
| ImageFile1 = Astaxanthin-3D-spacefill.png
| ImageSize = 320
| ImageAlt = Skeletal formula of astaxanthin
| ImageSize1 = 300
| ImageAlt1 = Space-filling model of the astaxanthin molecule
| OtherNames = β-Carotene-4,4'-dione, 3,3'-dihydroxy-, all-trans-; (3S,3'S)-Astaxanthin; (3S,3'S)-Astaxanthin; (3S,3'S)-all-trans-Astaxanthin; (S,S)-Astaxanthin; Astaxanthin, all-trans-; all-trans-Astaxanthin; trans-Astaxanthin <ref>SciFinder Web (accessed Sep 28, 2010). Astaxanthin (472-61-7) Name</ref>
| IUPACName = 3,3′-dihydroxy-β,β-carotene-4,4′-dione
| SystematicName = (6''S'')-6-Hydroxy-3-[(1''E'',3''E'',5''E'',7''E'',9''E'',11''E'',13''E'',15''E'',17''E'')-18-[(4''S'')-4-hydroxy-2,6,6-trimethyl-3-oxo-1-cyclohexenyl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethyl-1-cyclohex-2-enone
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444636
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 40968
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 445751
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8XPW32PR7I
| InChI = 1/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+
| InChIKey = MQZIGYBFDRPAKN-QISQUURKBE
| InChI1 = 1/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+/t35-,36-/m0/s1
| InChIKey1 = MQZIGYBFDRPAKN-UWFIBFSHBJ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+/t35-,36-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MQZIGYBFDRPAKN-UWFIBFSHSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=472-61-7
| PubChem=5281224
| SMILES = O=C2\C(=C(\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C1=C(\C(=O)[C@@H](O)CC1(C)C)C)C)C)C)C)C(C)(C)C[C@@H]2O)C
}}
| Section2 = {{Chembox Properties
| C=40 | H=52 | O=4
| MolarMass=596.84 g/mol
| Appearance= red solid powder
| Density= 1.071 g/mL <ref name="SciFinder Web p 28">SciFinder Web (accessed Sep 28, 2010). Astaxanthin (472-61-7) Experimental Properties.</ref>
| MeltingPtC= 216
| MeltingPt_ref = <ref name="SciFinder Web p 28"/>
| BoilingPtC= 774
| BoilingPt_ref = <ref name="SciFinder Web p 28"/>
| SolubleOther = 30 g/L in DCM; 10 g/L in CHCl<sub>3</sub>; 0.5 g/L in DMSO; 0.2 g/L in acetone
}}
| Section3 = {{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt=
}}
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 396294019
}}
Astaxanthin adalah jenis [[karotenoid]] yang ditemukan di lingkungan alam. Karotenoid adalah [[pigmen]] yang sering dikaitkan dengan [[sayuran]]. Jenis yang paling umum adalah beta-karoten yang dapat ditemukan dalam [[wortel]] dan ''lycopene'' di dalam [[tomat]], dan telah terbukti mengandung [[antioksidan]]. Dikenal sebagai pigmen merah, Astaxanthin adalah salah satu karotenoid yang memiliki kemampuan alami untuk bertahan melawan efek negatif akibat radikal bebas atau oksigen aktif. Pigmen merah ini juga ditemukan dalam berbagai jenis kehidupan laut, termasuk ikan [[salmon]], ikan ''sea bream'', telur salmon, udang dan rumput laut merah.
| |||