Also Obi is the founder of the acid he drinks i2Bongkrek acid (Bongkrek acid) is a toxin breathing more deadly than cyanide
{{chembox
| ImageFile = Bongkrekic acid.svg
| ImageCaption = Asam bongkrek (Asam 3-karboksimetil-17-metoksi-6,18,21-trimetildokosa- 2,4,8,12,18,20-heptaenedioat)
| ImageSize = 250px
| IUPACName = (2''E'',4''Z'',6''R'',8''Z'',10''E'',14''E'',17''S'',18''E'',20''Z'')-20-(carboxymethyl)-6-methoxy-2,5,17-trimethyldocosa-2,4,8,10,14,18,20-heptadioic acid
| OtherNames = Asam bongkrek
| Section1 = {{Chembox Identifiers
| Abbreviations =
| CASNo = 11076-19-0
| EINECS =
| PubChem = 6433556
| SMILES = O=C(O)C(\C)=C\C=C(\C)[C@@H](C/C=C\C=C\CC\C=C\C[C@H](C)/C=C/C(=C\C(=O)O)/CC(=O)O)OC
| InChI =
| RTECS =
| MeSHName =
| ChEBI =
| KEGG =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
|C=28|H=35|O=7
| MolarMass =
| Appearance =
| Density =
| MeltingPt = 50-60 °C
| Melting_notes =
| BoilingPt =
| Boiling_notes =
| Solubility =
| SolubleOther =
| Solvent =
| pKa =
| pKb = }}
| Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL = }}
}}
'''Asam bongkrek''' (''bongkrek acid'') adalah [[toksin]] pernapasan yang lebih mematikan daripada [[sianida]]..<ref>Peter J. F. Henderson and Henry A. Lardy, "Bongkrekic acid: An Inhibitor of Adenine Nucleotide Translocase of Mitochondria", [[Journal of Biological Chemistry]], (1970) 245, 6, 1319. [http://www.jbc.org/cgi/content/abstract/245/6/1319 Abstract, includes structure]</ref>
|