Buka menu utama

Perubahan

Tidak ada perubahan ukuran, 2 bulan yang lalu
Baru. Maraton 500.000 artikel
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 443833957
| IUPAC_name = (3''R'',4''R'',5''R'')-2-<nowiki/>{[(1''S'',2''S'',3''R'',4''S'',6''R'')-4,6-<br />diamino-3-<nowiki/>{[(2''R'',3''R'',6''S'')-<br />3-amino-6-[(1''R'')-<br />1-(metilamino)etil]oksan-2-yl]oksi}-<br />2-hidroksisikloheksil]oksi}-5-metil-<br />4-(metilamino)oksana-3,5-diol
| image = Gentamicin C2.svg
| image2 = Gentamicin.png
<!--Clinical data-->
| tradename = Cidomycin, Genticyn, Garamycin, lainnya
| pronounce = {{IPAc-en|ˌ|dʒ|ɛ|n|t|ə|ˈ|m|aɪ|s|ə|n}}
| Drugs.com = {{drugs.com|monograph|gentamicin-sulfate}}
| MedlinePlus = a682275
| pregnancy_AU = D
| pregnancy_US = D
| legal_status = Rx only
| routes_of_administration = Intravena, tetes mata, intramuskular, topikal
| class = [[Aminoglikosida]]
<!--Pharmacokinetic data-->
| bioavailability = rendah jika diminum
| protein_bound = 0–10%
| elimination_half-life = 2 jam
| excretion = Ginjal
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 1403-66-3
| ATC_prefix = D06
| ATC_suffix = AX07
| ATC_supplemental = {{ATC|J01|GB03}} {{ATC|S01|AA11}} {{ATC|S02|AA14}} {{ATC|S03|AA06}} {{ATCvet|A07|AA91}} {{ATCvet|G01|AA91}} {{ATCvet|G51|AA04}} {{ATCvet|J51|GB03}}
| PubChem = 3467
| IUPHAR_ligand = 2427
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00798
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390067
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T6Z9V48IKG
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08013
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27412
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 195892
<!--Chemical data-->
| C=21 | H=43 | N=5 | O=7
| molecular_weight = 477,596 g/mol
| smiles = O[C@]3(C)[C@H](NC)[C@@H](O)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]1O[C@H](C(NC)C)CC[C@H]1N)[C@@H]2O)OC3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3/t9?,10-,11+,12-,13+,14+,15-,16-,17+,18-,19-,20-,21+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CEAZRRDELHUEMR-URQXQFDESA-N
}}
<span data-segmentid="212" class="cx-segment">'''Gentamisin''', dipasarkan dengan nama dagang '''Garamycin''' dan lainnya, adalah [[Antibiotika|antibiotik]]. Gentamisin digunakan untuk mengobati beberapa jenis infeksi bakteri<ref name="AHFS2015">{{Cite web|url=https://www.drugs.com/monograph/gentamicin-sulfate.html|title=Gentamicin sulfate|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20150816010048/http://www.drugs.com/monograph/gentamicin-sulfate.html|archive-date=2015-08-16|dead-url=no|access-date=Aug 15, 2015}}</ref></span> seperti <span data-segmentid="215" class="cx-segment">[[Osteomielitis|infeksi tulang]], [[endokarditis]], radang pada panggul, [[meningitis]], [[Radang paru-paru|pneumonia]], [[infeksi saluran kemih]], dan [[sepsis]].<ref name="AHFS2015" /></span> Gentamisin <span data-segmentid="223" class="cx-segment">tidak efektif untuk mengobati [[Kencing nanah|gonore]] atau [[Infeksi Chlamydia|infeksi klamidia]].<ref name="AHFS2015" /></span> Obat ini d<span data-segmentid="226" class="cx-segment">apat diberikan secara intravena, intramuskular, atau topikal.<ref name="AHFS2015" /></span> <span data-segmentid="230" class="cx-segment">Sediaan topikal digunakan pada luka bakar atau infeksi pada bagian luar mata.<ref>{{Cite book|last=Bartlett|first=Jimmy|title=Clinical Ocular Pharmacology|date=2013|publisher=Elsevier|isbn=9781483193915|page=214|edition=s|url=https://books.google.ca/books?id=kA8lBQAAQBAJ&pg=PA214|dead-url=no|archive-url=https://web.archive.org/web/20151222132453/https://books.google.ca/books?id=kA8lBQAAQBAJ&pg=PA214|archive-date=2015-12-22}}</ref></span> <span data-segmentid="231" class="cx-segment">Di negara maju, gentamisin hanya digunakan selama dua hari sampai hasil [[Kultur mikrobiologi|kultur bakteri]] dapat menentukan bakteri spesifik dan antibiotik yang spesifik pula.<ref name="ap01">{{Cite journal|last=Moulds, Robert|last2=Jeyasingham, Melanie|date=October 2010|title=Gentamicin: a great way to start|url=http://www.australianprescriber.com/magazine/33/5/134/5|dead-url=yes|journal=Australian Prescriber|issue=33|pages=134–135|archive-url=https://web.archive.org/web/20110313150546/http://www.australianprescriber.com/magazine/33/5/134/5|archive-date=2011-03-13}}</ref></span>

<span data-segmentid="234" class="cx-segment">Gentamisin dapat menyebabkan ototoksisitas dan nefrotoksisitas.<ref name="AHFS2015" /></span> Ototoksisitas yang terjadi antara lain <span data-segmentid="237" class="cx-segment">masalah keseimbangan dan [[Ketulian|gangguan pendengaran]].<ref name="AHFS2015" /></span> Toksisitas tersebut dapat menjadi permanen<span data-segmentid="239" class="cx-segment">.<ref name="AHFS2015" /></span> Gentamisin dapat membahayakan janin jika dipakai <span data-segmentid="240" class="cx-segment">selama [[kehamilan]].<ref name="AHFS2015" /></span> <span data-segmentid="242" class="cx-segment">Namun, gentamisin nampak aman untuk digunakan selama [[menyusui]].<ref name="GenB">{{Cite web|url=https://www.drugs.com/breastfeeding/gentamicin.html|title=Gentamicin use while breastfeeding|archive-url=https://web.archive.org/web/20150906222610/http://www.drugs.com/breastfeeding/gentamicin.html|archive-date=6 September 2015|dead-url=no|access-date=15 August 2015}}</ref></span> <span data-segmentid="244" class="cx-segment">Gentamicin adalah antibiotik tipe [[aminoglikosida]]</span> yang <span data-segmentid="246" class="cx-segment">bekerja dengan mengganggu kemampuan bakteri untuk melakukan sintesis protein, sehingga dapat [[Bakterisida|membunuh bakteri]].<ref name="AHFS2015" /></span>

<span data-segmentid="248" class="cx-segment">Gentamisin dipatenkan pada 1962 dan disetujui untuk dipasarkan pada 1964.<ref name="Fis2006">{{Cite book|last=Fischer|first=Jnos|last2=Ganellin|first2=C. Robin|title=Analogue-based Drug Discovery|date=2006|publisher=John Wiley & Sons|isbn=9783527607495|page=507|url=https://books.google.ca/books?id=FjKfqkaKkAAC&pg=PA507|language=en}}</ref></span> Gentamisin diisolasi dari <span data-segmentid="249" class="cx-segment">''Micromonospora purpurea''.<ref name="AHFS2015" /></span> <span data-segmentid="251" class="cx-segment">Gentamisin terdapat dalam [[Daftar Obat Esensial Organisasi Kesehatan Dunia]].<ref name="WHO19th">{{Cite web|url=http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|title=WHO Model List of Essential Medicines (19th List)|date=April 2015|website=World Health Organization|archive-url=https://web.archive.org/web/20161213052708/http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|archive-date=13 December 2016|dead-url=no|access-date=8 December 2016}}</ref></span> Gentamisin <span data-segmentid="254" class="cx-segment">tersedia dalam bentuk [[Obat generik|generik]].<ref>{{Cite book|last=Burchum|first=Jacqueline|title=Lehne's pharmacology for nursing care|date=2014|publisher=Elsevier Health Sciences|isbn=9780323340267|page=1051|url=https://books.google.ca/books?id=C7_NBQAAQBAJ&pg=PA1052|dead-url=no|archive-url=https://web.archive.org/web/20160311015121/https://books.google.ca/books?id=C7_NBQAAQBAJ&pg=PA1052|archive-date=2016-03-11}}</ref></span> Harga gentamisin <span data-segmentid="256" class="cx-segment">injeksi di [[negara berkembang]] pada tahun 2014 sebesar [[Dolar Amerika Serikat|US$]]0,05-0,58 per [[Liter|mL]].<ref>{{Cite web|url=http://mshpriceguide.org/en/single-drug-information/?DMFId=369&searchYear=2014|title=Gentamicin sulfate|website=International Drug Price Indicator Guide|archive-url=https://web.archive.org/web/20180122072149/http://mshpriceguide.org/en/single-drug-information/?DMFId=369&searchYear=2014|archive-date=22 January 2018|dead-url=yes|access-date=15 August 2015}}</ref></span>

== Indikasi ==
<span data-segmentid="261" class="cx-segment">Gentamisin diindikasikan untuk mengobati berbagai infeksi bakteri yang sebagian besar bakteri Gram-negatif seperti ''[[Pseudomonas]]'', ''Proteus'', ''[[Escherichia coli]]'', ''[[Klebsiella pneumoniae]]'', ''Enterobacter aerogenes'', dan ''[[Serratia]].'' Gentamisin juga dapat digunakan untuk mengobati infeksi ''[[Staphylococcus]]'' Gram-positif.<ref name=":1">{{Cite web|url=http://www.baxter.ca/en/downloads/product_information/GENTAMICIN(E)_PM_AUG282012_EN.pdf|title=Gentamicin|publisher=Baxter Corporation|archive-url=https://web.archive.org/web/20160304124731/http://www.baxter.ca/en/downloads/product_information/GENTAMICIN(E)_PM_AUG282012_EN.pdf|archive-date=4 March 2016|dead-url=yes|access-date=2 November 2015}}</ref></span> <span data-segmentid="268" class="cx-segment">Gentamisin digunakan untuk pengobatan infeksi saluran pernapasan, infeksi saluran kemih, infeksi darah, tulang, dan jaringan lunak yang disebabkan bakteri yang sensitif terhadap gentamisin.<ref name=":0">{{Cite web|url=http://www.sandoz.ca/cs/groups/public/@sge_ca/documents/document/n_prod_1301121.pdf|title=Product Monograph|publisher=Sandoz Canada Inc|archive-url=https://web.archive.org/web/20150412102019/http://www.sandoz.ca/cs/groups/public/%40sge_ca/documents/document/n_prod_1301121.pdf|archive-date=12 April 2015|dead-url=no|access-date=2 November 2015}}</ref></span>

<span data-segmentid="269" class="cx-segment">Tidak terdapat bukti cukup yang merekomendasikan gentamisin sebagai lini pertama pengobatan infeksi ''[[Neisseria gonorrhoeae|Neisseria gonore]]''.<ref>{{Cite journal|last=Emma|first=Hathorn|last2=Divya|first2=Dhasmana|last3=Lelia|first3=Duley|last4=Jonathan|first4=DC Ross|date=2014|title=The effectiveness of gentamicin in the treatment of Neisseria gonorrhoeae: a systematic review|journal=Systematic Review|volume=3|pages=104|doi=10.1186/2046-4053-3-104|pmc=4188483|pmid=25239090}}</ref></span> <span data-segmentid="271" class="cx-segment">Gentamisin tidak digunakan untuk mengobati infeksi yang disebabkan ''[[Neisseria meningitidis]]'' atau ''[[Legionella pneumophila]]'' (karena terdapat risiko terjadinya syok akibat [[Lipopolisakarida|endotoksin]] yang dihasilkan organisme Gram-negatif tertentu).</span> <span data-segmentid="275" class="cx-segment">Gentamisin juga dapat digunakan untuk melawan ''[[Yersinia pestis]]'' dan ''[[Francisella tularensis]]''.<ref>{{Cite book|last=Goljan|first=Edward F.|title=Rapid Review Pathology|edition=3rd|year=2011|publisher=Elsevier|location=Philadelphia, Pennsylvania|isbn=978-0-323-08438-3|pages=241}}</ref></span>

<span data-segmentid="279" class="cx-segment">Beberapa ''[[Enterobacteriaceae]]'', ''[[Pseudomonas]] spp.'', ''[[Enterococcus]] spp.'', ''[[Staphylococcus aureus]]'' dan ''[[Staphylococcus]] spp,'' lainnya memiliki [[Resistansi antibiotik|resistensi]] terhadap gentamisin dengan tingkat yang bervariasi.<ref>{{Cite web|url=http://www.toku-e.com/Upload/Products/PDS/20120604005203.pdf|title=Gentamicin spectrum of bacterial susceptibility and Resistance|archive-url=https://web.archive.org/web/20150220033338/http://www.toku-e.com/Upload/Products/PDS/20120604005203.pdf|archive-date=20 February 2015|dead-url=yes|access-date=15 May 2012}}</ref></span>

== Efek samping ==
<span data-segmentid="287" class="cx-segment">Efek samping yang terjadi setelah penggunaan gentamisin bervariasi mulai yang ringan seperti mual dan muntah, hingga reaksi yang lebih berat seperti:<ref name=":1" /></span>

* <span data-segmentid="288" class="cx-segment">Jumlah sel darah rendah</span>
* [[Hipersensitivitas|Reaksi alergi]]
* <span data-segmentid="291" class="cx-segment">Masalah neuromuskuler</span>
* <span data-segmentid="293" class="cx-segment">Kerusakan saraf (neuropati)</span>
* <span data-segmentid="295" class="cx-segment">Kerusakan ginjal (nefrotoksisitas)</span>
* <span data-segmentid="297" class="cx-segment">Gangguan telinga (ototoksisitas)</span>

<span data-segmentid="299" class="cx-segment">[[Nefrotoksisitas]] dan [[ototoksisitas]] berkaitan dengan dosis yang diberikan. Dosis yang lebih tinggi dapat menyebabkan toksisitas yang lebih berat.<ref name=":1" /></span> Gejala k<span data-segmentid="302" class="cx-segment">edua toksisitas ini mungkin tidak timbul segera, terkadang baru muncul setelah menyelesaikan pengobatan.<ref name=":1" /></span>

=== Kerusakan ginjal ===
<span data-segmentid="304" class="cx-segment">Kerusakan ginjal dialami oleh 10-25% dari pasien yang mendapat pengobatan dengan aminoglikosida. Gentamisin adalah salah satu obat yang paling nefrotoksik di kelas tersebut.<ref name=":2">{{Cite journal|last=Lopez-Novoa|first=Jose M|last2=Quiros|first2=Yaremi|last3=Vicente|first3=Laura|last4=Morales|first4=Ana I|last5=Lopez-Hernandez|first5=Francisco J|date=Jan 2011|title=New insights into the mechanism of aminoglycoside nephrotoxicity: an integrative point of view|journal=Kidney International|volume=79|issue=1|pages=33–45|doi=10.1038/ki.2010.337|pmid=20861826}}</ref></span> <span data-segmentid="306" class="cx-segment">Seringkali, nefrotoksisitas akut bersifat reversibel, tetapi mungkin dapat berakibat fatal.<ref name=":1" /></span> <span data-segmentid="307" class="cx-segment">Risiko nefrotoksisitas dipengaruhi oleh dosis, frekuensi, durasi terapi, dan penggunaan bersamaan dengan obat-obatan tertentu, seperti [[Obat antiinflamasi nonsteroid|AINS]], [[diuretik]], [[sisplatin]], [[Siklosporina|siklosporin]], [[sefalosporin]], [[Amfoterisin B|amfoterisin]], media kontras iodida, dan [[vankomisin]].<ref name=":2" /></span>

<span data-segmentid="316" class="cx-segment">Faktor-faktor yang dapat meningkatkan risiko nefrotoksisitas antara lain: <ref name=":2" /></span>

* <span data-segmentid="317" class="cx-segment">Umur</span>
* <span data-segmentid="318" class="cx-segment">Penurunan [[Laju filtrasi glomerular|fungsi ginjal]]</span>
* <span data-segmentid="320" class="cx-segment">Kehamilan</span>
* [[Hipotiroidisme]]
* <span data-segmentid="323" class="cx-segment">Gangguan fungsi hati</span>
* Penurunan volume air
* [[Asidosis metabolik]]
* <span data-segmentid="327" class="cx-segment">Penurunan jumlah natrium</span>

<span data-segmentid="328" class="cx-segment">Fungsi ginjal pasien ketika menggunakan gentamisin harus dipantau dengan mengukur [[Kreatinina|kreatinin]] dalam darah, kadar elektrolit, keluaran urin, [[Proteinuria|adanya protein dalam urin]], dan kadar bahan kimia lainnya, seperti urea, dalam darah.<ref name=":2" /></span>

=== Kerusakan telinga dalam ===
<span data-segmentid="333" class="cx-segment">Sekitar 11% dari pasien yang mendapat pengobatan dengan aminoglikosida mengalami kerusakan pada [[telinga dalam]].<ref>{{Cite journal|last=East|first=J E|last2=Foweraker|first2=J E|last3=Murgatroyd|first3=F D|date=2005-05-01|title=Gentamicin induced ototoxicity during treatment of enterococcal endocarditis: resolution with substitution by netilmicin|journal=Heart|volume=91|issue=5|pages=e32|doi=10.1136/hrt.2003.028308|issn=1355-6037|pmc=1768868|pmid=15831617}}</ref></span> <span data-segmentid="335" class="cx-segment">Gejala kerusakan telinga dalam antara lain [[tinitus]], gangguan pendengaran, [[vertigo]], [[ataksia]], dan limbung.<ref name=":3">{{Cite journal|last=Selimoglu|first=Erol|date=2007-01-01|title=Aminoglycoside-induced ototoxicity|journal=Current Pharmaceutical Design|volume=13|issue=1|pages=119–126|doi=10.2174/138161207779313731|issn=1873-4286|pmid=17266591}}</ref></span> <span data-segmentid="339" class="cx-segment">Penggunaan gentamisin dalam jangka panjang dapat me</span><span data-segmentid="340" class="cx-segment">rusak sel-sel rambut telinga dalam</span><span data-segmentid="339" class="cx-segment">,</span> <span data-segmentid="339" class="cx-segment">sehingga</span> <span data-segmentid="340" class="cx-segment">menyebabkan gangguan pendengaran</span> <span data-segmentid="339" class="cx-segment">yang</span> <span data-segmentid="340" class="cx-segment">ireversibel.</span> Selain itu, gentamisin juga dapat mer<span data-segmentid="341" class="cx-segment">usak vestibular telinga dalam, sehingga menyebabkan masalah keseimbangan.<ref name=":3" /></span> <span data-segmentid="343" class="cx-segment">Untuk mengurangi risiko ototoksisitas, pasien disarankan untuk rajin minum air.<ref name=":1" /></span>

<span data-segmentid="344" class="cx-segment">Faktor-faktor yang dapat meningkatkan risiko kerusakan telinga dalam antara lain:<ref name=":1" /><ref name=":0" /></span>

* <span data-segmentid="345" class="cx-segment">Umur</span>
* [[Uremia|<span data-segmentid="346" class="cx-segment">Kadar asam urat darah tinggi</span>]]
* <span data-segmentid="348" class="cx-segment">Disfungsi ginjal</span>
* <span data-segmentid="349" class="cx-segment">Disfungsi hati</span>
* <span data-segmentid="350" class="cx-segment">Penggunaan pada dosis tinggi</span>
* <span data-segmentid="351" class="cx-segment">Jangka waktu terapi yang panjang</span>
* <span data-segmentid="352" class="cx-segment">Mengonsumsi diuretik kuat bersamaan (contoh [[Furosemida]])</span>

== Kontraindikasi ==
<span data-segmentid="385" class="cx-segment">Gentamisin dikontraindikasikan pada pasien dengan riwayat [[Hipersensitivitas|hipersensitif]], seperti [[anafilaksis]], atau reaksi toksik serius lainnya terhadap gentamisin atau [[aminoglikosida]] lainnya.<ref name=":0" /></span>

== Referensi ==
<references />
[[Kategori:Obat Esensial Organisasi Kesehatan Dunia]]